/* ========================================
   SOU MAIS BAMBUÍ - Portal de Notícias
   CSS Compilado - Fiel à imagem de referência
   ======================================== */

/* ---- RESET ---- */
*, *::before, *::after { box-sizing: border-box; margin: 0; padding: 0; }
body { font-family: 'Montserrat', -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, sans-serif; font-size: 15px; line-height: 1.5; color: #1a1a1a; background-color: #f4f4f4; }

a { color: inherit; text-decoration: none; }
ul, ol { list-style: none; }
img { max-width: 100%; height: auto; display: block; }
button { cursor: pointer; font-family: inherit; }
.sr-only { position: absolute; width: 1px; height: 1px; padding: 0; margin: -1px; overflow: hidden; clip: rect(0,0,0,0); white-space: nowrap; border: 0; }
.skip-link { position: absolute; top: -40px; left: 0; background: #FF6B00; color: #fff; padding: 8px 16px; z-index: 10000; font-weight: 700; }
.skip-link:focus { top: 0; }
.container { max-width: 1240px; margin: 0 auto; padding: 0 16px; }

/* ---- HEADER ---- */
.main-header { background-color: #004D34; color: #fff; position: sticky; top: 0; z-index: 1000; box-shadow: 0 2px 6px rgba(0,0,0,0.25); }
.main-header__container { display: flex; align-items: center; justify-content: space-between; min-height: 64px; padding: 0 16px; gap: 20px; }
.main-header__brand { flex-shrink: 0; }
.main-header__logo-link { display: flex; align-items: center; text-decoration: none; }
.main-header__logo-img { height: 48px; width: auto; max-width: 200px; object-fit: contain; display: block; }


.main-header__nav { flex: 1; }
.main-header__menu { display: flex; gap: 2px; }
.main-header__item { display: flex; }
.main-header__link { display: block; color: rgba(255,255,255,0.85); font-weight: 600; font-size: 0.82rem; padding: 8px 10px; text-transform: uppercase; letter-spacing: 0.3px; transition: color 0.15s, background 0.15s; border-radius: 3px; white-space: nowrap; }
.main-header__link:hover, .main-header__link.active { color: #fff; background: rgba(255,255,255,0.12); }

.main-header__actions { display: flex; align-items: center; gap: 12px; flex-shrink: 0; }
.main-header__social { display: flex; gap: 8px; }
.main-header__social-icon { display: flex; align-items: center; justify-content: center; width: 30px; height: 30px; color: #fff; opacity: 0.8; border-radius: 50%; transition: opacity 0.15s; }
.main-header__social-icon:hover { opacity: 1; }
.main-header__search { display: flex; align-items: center; background: rgba(255,255,255,0.12); border-radius: 20px; padding: 5px 12px; border: 1px solid rgba(255,255,255,0.2); }
.main-header__search-input { border: none; background: transparent; color: #fff; font-size: 0.8rem; outline: none; width: 120px; }
.main-header__search-input::placeholder { color: rgba(255,255,255,0.5); }
.main-header__search-btn { background: transparent; border: none; color: #fff; padding: 0; display: flex; align-items: center; }
.main-header__toggle { display: none; flex-direction: column; gap: 5px; background: transparent; border: 1px solid rgba(255,255,255,0.3); padding: 8px; border-radius: 4px; }
.main-header__toggle-bar { width: 22px; height: 2px; background-color: #fff; border-radius: 2px; }
/* Mobile nav open state */
.main-header__nav.active .main-header__menu { display: flex; flex-direction: column; position: absolute; top: 64px; left: 0; right: 0; background: #003d29; padding: 12px; gap: 4px; z-index: 999; }

/* ---- PAGE WRAPPER ---- */
.page-home { background: #fff; }
.main-body { background-color: #f0f0f0; }
.main-body > .container, .page-home { background: #fff; }

/* ---- TOP BANNER AD ---- */
.top-banner-wrapper { background: #fff; padding: 10px 0; border-bottom: 1px solid #e0e0e0; }
.top-banner-wrapper .ad-block__label { text-align: center; font-size: 0.65rem; text-transform: uppercase; color: #aaa; letter-spacing: 1px; margin-bottom: 6px; }
.top-banner__link { display: block; }
.top-banner__img { width: 100%; max-height: 150px; object-fit: cover; }
.ad-placeholder { background: linear-gradient(135deg, #1a1a2e 0%, #16213e 50%, #0f3460 100%); color: rgba(255,255,255,0.7); display: flex; align-items: center; justify-content: center; font-size: 0.85rem; font-weight: 600; }
.ad-placeholder--horizontal { width: 100%; height: 130px; }
.ad-placeholder--vertical { width: 100%; height: 250px; }
.ad-placeholder--top { height: 130px; background: linear-gradient(90deg, #1a1a2e 0%, #162350 100%); }
.ad-block__label { font-size: 0.65rem; text-transform: uppercase; color: #aaa; letter-spacing: 1px; margin-bottom: 4px; text-align: right; }

/* ---- HERO MOSAIC (Destaques Principais) ---- */
.hero-mosaic { margin: 0; }
.hero-mosaic__grid {
    display: grid;
    grid-template-columns: 1.9fr 1fr;
    gap: 2px;
    height: 460px;
}
.hero-mosaic__secondary-stack { display: flex; flex-direction: column; gap: 2px; height: 100%; }
.hero-card { position: relative; overflow: hidden; background-color: #1a1a1a; }
.hero-card--main { height: 100%; }
.hero-card--secondary { flex: 1; min-height: 0; }
.hero-card__link { display: block; width: 100%; height: 100%; }
.hero-card__bg {
    position: absolute;
    inset: 0;
    background-size: cover;
    background-position: center;
    transition: transform 0.4s ease;
}
.hero-card:hover .hero-card__bg { transform: scale(1.05); }
/* Overlay: gradiente escuro mais forte na base */
.hero-card__overlay {
    position: absolute;
    inset: 0;
    background: linear-gradient(
        to top,
        rgba(0,0,0,0.80) 0%,
        rgba(0,0,0,0.20) 40%,
        transparent 65%
    );
}
.hero-card__content {
    position: absolute;
    bottom: 0;
    left: 0;
    right: 0;
    padding: 18px 20px;
    z-index: 2;
}
/* Badge estilo da referência: fundo branco semi-transparente, texto escuro */
.hero-card__badge {
    display: inline-block;
    background: rgba(255,255,255,0.92);
    color: #111;
    font-size: 0.72rem;
    font-weight: 700;
    padding: 3px 10px;
    letter-spacing: 0.2px;
    margin-bottom: 8px;
}
/* Título principal (card grande) */
.hero-card--main .hero-card__title {
    font-size: 1.7rem;
    font-weight: 800;
    line-height: 1.2;
    color: #fff;
    margin: 0;
    text-shadow: 0 1px 3px rgba(0,0,0,0.6);
    display: -webkit-box;
    -webkit-line-clamp: 3;
    line-clamp: 3;
    -webkit-box-orient: vertical;
    overflow: hidden;
}
/* Título cards secundários */
.hero-card__title {
    font-size: 1rem;
    font-weight: 700;
    line-height: 1.3;
    color: #fff;
    margin: 0;
    text-shadow: 0 1px 3px rgba(0,0,0,0.5);
    display: -webkit-box;
    -webkit-line-clamp: 3;
    line-clamp: 3;
    -webkit-box-orient: vertical;
    overflow: hidden;
}


/* ---- BADGES ---- */
.badge { display: inline-block; padding: 4px 10px; font-size: 0.78rem; font-weight: 700; text-transform: uppercase; letter-spacing: 0.4px; border-radius: 2px; }
.badge--green { background-color: #004D34; color: #fff; }
.badge--orange { background-color: #FF6B00; color: #fff; }
.badge--price { background-color: #e8f5e9; color: #004D34; font-weight: 700; }
.badge--small { font-size: 0.68rem; padding: 2px 6px; }


/* ---- 2-COLUMN GRID (Main + Sidebar) ---- */
.content-sidebar-grid { display: grid; grid-template-columns: 1fr 300px; gap: 20px; padding: 20px 0; }
.main-column { min-width: 0; }
.sidebar-column { min-width: 0; }

/* ---- SECTION HEADERS (caixa verde + linha cinza, igual à imagem de referência) ---- */
.section-box { margin-bottom: 28px; }
.section-header { display: flex; align-items: center; margin-bottom: 14px; gap: 0; }
.section-title {
    background-color: #004D34;
    color: #fff;
    font-size: 0.82rem;
    font-weight: 800;
    text-transform: uppercase;
    letter-spacing: 0.5px;
    padding: 8px 16px;
    margin: 0;
    white-space: nowrap;
    flex-shrink: 0;
}
.section-header__line {
    flex: 1;
    height: 1px;
    background-color: #d0d0d0;
    align-self: center;
}

/* ---- NEWS LIST (Destaques da Semana) ---- */
.news-list { display: flex; flex-direction: column; }
.news-item {
    display: flex;
    gap: 16px;
    padding: 16px 0;
    border-bottom: 1px solid #ebebeb;
    align-items: flex-start;
}
.news-item:last-child { border-bottom: none; }
.news-item__thumb {
    width: 160px;
    height: 160px;
    flex-shrink: 0;
    overflow: hidden;
    background: #1c2936;
    border-radius: 0;
}
.news-item__thumb img {
    width: 100%;
    height: 100%;
    object-fit: cover;
    transition: transform 0.2s;
}
.news-item:hover .news-item__thumb img { transform: scale(1.04); }
/* Fallback for missing images */
.news-item__thumb-placeholder { width: 100%; height: 100%; background: linear-gradient(135deg, #1c3a1c 0%, #2a5a2a 100%); }
.news-item__details {
    flex: 1;
    min-width: 0;
    display: flex;
    flex-direction: column;
    align-items: flex-start;
}
.news-item__title {
    font-size: 1.12rem;
    font-weight: 700;
    color: #111;
    line-height: 1.35;
    margin: 8px 0 10px;
    display: -webkit-box;
    -webkit-line-clamp: 3;
    line-clamp: 3;
    -webkit-box-orient: vertical;
    overflow: hidden;
}
.news-item__title a { color: #111; text-decoration: none; }
.news-item__title a:hover { color: #004D34; }
.news-item__meta {
    font-size: 0.84rem;
    color: #333;
    line-height: 1.5;
    margin-top: auto;
}
.news-item__meta-line {
    margin-bottom: 2px;
}

/* Pagination dots */
.pagination-dots { display: flex; justify-content: center; gap: 8px; margin-top: 20px; padding-top: 8px; }
.pagination-dot { width: 9px; height: 9px; border-radius: 50%; background: #ccc; border: none; padding: 0; transition: background 0.2s; cursor: pointer; }
.pagination-dot.active { background: #004D34; }


/* ---- CAROUSEL (Registros da Semana) ---- */
.carousel-wrapper { position: relative; overflow: hidden; }
.carousel-track { display: flex; gap: 12px; overflow-x: auto; scroll-snap-type: x mandatory; scrollbar-width: none; padding: 4px 0; }
.carousel-track::-webkit-scrollbar { display: none; }
.registro-card { flex: 0 0 calc(33.333% - 8px); scroll-snap-align: start; }
.registro-card__thumb { height: 170px; overflow: hidden; background: #1c2936; border-radius: 3px; }
.registro-card__thumb img { width: 100%; height: 100%; object-fit: cover; }
.registro-card__title { font-size: 0.85rem; font-weight: 700; margin-top: 8px; color: #222; padding: 0 2px; }
/* Demo dark placeholders like reference image */
.registro-card__thumb--demo { background: linear-gradient(135deg, #111 0%, #222 100%); height: 170px; }
.carousel-btn { position: absolute; top: 50%; transform: translateY(-50%); z-index: 10; background: rgba(0,0,0,0.5); color: #fff; border: none; width: 36px; height: 36px; display: flex; align-items: center; justify-content: center; border-radius: 50%; transition: background 0.2s; }
.carousel-btn:hover { background: rgba(0,0,0,0.75); }
.carousel-btn--prev { left: -8px; }
.carousel-btn--next { right: -8px; }

/* ---- SIDEBAR BLOCKS ---- */
.sidebar { display: flex; flex-direction: column; gap: 24px; }
.sidebar-block { background: transparent; }

/* 1. Weather Box (Tempo agora) */
.weather-box {
    background: #fff;
    border: 1px solid #e2e2e2;
    padding: 16px 18px;
    display: flex;
    align-items: center;
    gap: 16px;
    margin-top: 4px;
}
.weather-box__icon {
    flex-shrink: 0;
    display: flex;
    align-items: center;
    justify-content: center;
}
.weather-box__content { flex: 1; min-width: 0; }
.weather-box__icon img { display: block; width: 64px; height: 64px; object-fit: contain; }
.weather-box__source { margin-top: 5px; color: #6d7774; font-size: .55rem; }
.weather-box__city {
    font-size: 1.15rem;
    font-weight: 800;
    color: #111;
    margin: 0 0 2px;
}
.weather-box__datetime {
    font-size: 0.82rem;
    color: #333;
    margin-bottom: 8px;
}
.weather-box__bottom {
    display: flex;
    align-items: center;
    gap: 14px;
}
.weather-box__temp {
    font-size: 1.35rem;
    font-weight: 800;
    color: #111;
    white-space: nowrap;
}
.weather-box__unit {
    font-size: 1rem;
    font-weight: 600;
}
.weather-box__divider {
    width: 1px;
    height: 48px;
    background-color: #ddd;
    flex-shrink: 0;
}
.weather-box__stats {
    font-size: 0.82rem;
    color: #111;
    line-height: 1.4;
    font-weight: 500;
}

/* 2. Mais Lidas */
.most-read__list {
    display: flex;
    flex-direction: column;
    gap: 18px;
    margin-top: 12px;
}
.most-read__item { margin: 0; }
.most-read__title {
    font-size: 1.12rem;
    font-weight: 700;
    line-height: 1.3;
    margin: 0;
}
.most-read__title a {
    color: #000;
    text-decoration: none;
    transition: color 0.15s;
}
.most-read__title a:hover { color: #004D34; }


/* 3. Publicidades */
.ad-block__content { margin-top: 6px; }
.ad-placeholder-black {
    background-color: #000;
    width: 100%;
    height: 280px;
}

/* 4. Agenda Bambuí */
.agenda-list { display: flex; flex-direction: column; gap: 10px; margin-top: 6px; }
.agenda-card {
    display: flex;
    gap: 12px;
    align-items: center;
    background: #fff;
    border: 1px solid #eee;
    padding: 10px;
}
.agenda-card__date-badge {
    background: #004D34;
    color: #fff;
    padding: 6px 10px;
    text-align: center;
    border-radius: 2px;
    flex-shrink: 0;
}
.agenda-card__day { font-size: 1.2rem; font-weight: 800; display: block; line-height: 1; }
.agenda-card__month { font-size: 0.65rem; font-weight: 700; }
.agenda-card__title { font-size: 0.9rem; font-weight: 700; margin: 0 0 2px; }
.agenda-card__title a { color: #111; text-decoration: none; }
.agenda-card__location { font-size: 0.75rem; color: #666; margin: 0; }



/* Ad Block Sidebar */
.ad-block { padding: 0; border: 1px dashed #ccc; background: #fafafa; }
.ad-block .sidebar-block__body { padding: 8px; }
.ad-block img { width: 100%; border-radius: 2px; }

/* Agenda Bambuí */
.agenda-list { display: flex; flex-direction: column; gap: 10px; padding: 10px 12px; }
.agenda-card { display: flex; gap: 10px; align-items: flex-start; }
.agenda-card__date-badge { display: flex; flex-direction: column; align-items: center; justify-content: center; background: #004D34; color: #fff; min-width: 40px; height: 44px; border-radius: 3px; flex-shrink: 0; }
.agenda-card__day { font-size: 1.1rem; font-weight: 900; line-height: 1; }
.agenda-card__month { font-size: 0.6rem; text-transform: uppercase; font-weight: 700; }
.agenda-card__info { flex: 1; }
.agenda-card__title { font-size: 0.8rem; font-weight: 700; color: #1a1a1a; margin-bottom: 3px; line-height: 1.3; }
.agenda-card__title a:hover { color: #004D34; }
.agenda-card__location { font-size: 0.7rem; color: #888; margin-bottom: 4px; }

/* Ofertas Locais Sidebar */
.ofertas-list { display: flex; flex-direction: column; gap: 0; }
.oferta-card { padding: 10px 12px; border-bottom: 1px solid #f0f0f0; }
.oferta-card:last-child { border-bottom: none; }
.oferta-card__badge { display: inline-block; background: #FF6B00; color: #fff; font-size: 0.6rem; font-weight: 700; text-transform: uppercase; padding: 2px 6px; border-radius: 2px; margin-bottom: 4px; }
.oferta-card__title { font-size: 0.82rem; font-weight: 700; color: #1a1a1a; margin-bottom: 2px; }
.oferta-card__business { font-size: 0.72rem; color: #777; margin-bottom: 6px; }
.oferta-card__pricing { display: flex; align-items: baseline; gap: 8px; margin-bottom: 8px; }
.oferta-card__old-price { font-size: 0.72rem; color: #aaa; text-decoration: line-through; }
.oferta-card__promo-price { font-size: 1rem; font-weight: 900; color: #004D34; }

/* ---- FALA CIDADÃO ---- */
.fala-cidadao__grid { display: grid; grid-template-columns: 1fr 1fr; gap: 16px; }
.fala-cidadao__left { background: #fff; border: 1px solid #e4e4e4; border-radius: 3px; padding: 16px; }
.fala-cidadao__subtitle { font-size: 0.82rem; color: #666; margin-bottom: 14px; font-style: italic; }
.fala-cidadao__card { background: #f9f9f9; border: 1px solid #eee; padding: 14px; border-radius: 3px; }
.fala-cidadao__card-header { display: flex; align-items: center; gap: 10px; margin-bottom: 10px; }
.fala-cidadao__avatar { color: #bbb; flex-shrink: 0; }
.fala-cidadao__user-info { display: flex; flex-direction: column; gap: 3px; }
.fala-cidadao__author { font-size: 0.85rem; font-weight: 700; color: #333; }
.fala-cidadao__message { font-size: 0.88rem; color: #444; font-style: italic; line-height: 1.5; margin-bottom: 8px; }
.fala-cidadao__date { font-size: 0.7rem; color: #aaa; }

/* Right form card - dark green */
.fala-cidadao__right { background-color: #004D34; border-radius: 3px; padding: 20px; }
.fala-cidadao__form-title { font-size: 1rem; font-weight: 800; color: #fff; margin-bottom: 14px; text-align: center; }
.fala-cidadao__tabs { display: flex; gap: 6px; margin-bottom: 14px; }
.fala-cidadao__tab-label { flex: 1; }
.fala-cidadao__tab-btn { display: block; text-align: center; padding: 7px 8px; background: rgba(255,255,255,0.15); color: #fff; border-radius: 3px; font-size: 0.75rem; font-weight: 600; cursor: pointer; transition: background 0.15s; }
input[type="radio"]:checked + .fala-cidadao__tab-btn { background: #FF6B00; }
.fala-cidadao__tabs input[type="radio"]:focus + .fala-cidadao__tab-btn { outline: 2px solid #fff; }
.fala-cidadao__disclaimer { font-size: 0.7rem; color: rgba(255,255,255,0.6); text-align: center; margin-top: 10px; }

/* ---- FORMS & BUTTONS ---- */
.form-group { margin-bottom: 10px; }
.form-label { font-size: 0.78rem; color: rgba(255,255,255,0.85); display: block; margin-bottom: 4px; }
.form-label--file-btn { display: inline-flex; align-items: center; gap: 6px; background: rgba(255,255,255,0.15); color: #fff; padding: 7px 12px; border-radius: 3px; font-size: 0.78rem; cursor: pointer; width: 100%; justify-content: center; }
.form-control { width: 100%; padding: 9px 10px; border: 1px solid rgba(255,255,255,0.2); border-radius: 3px; font-size: 0.85rem; background: rgba(255,255,255,0.92); color: #1a1a1a; outline: none; }
.form-control:focus { border-color: #FF6B00; box-shadow: 0 0 0 2px rgba(255,107,0,0.25); }
textarea.form-control { resize: vertical; min-height: 80px; }
.form-check { display: flex; align-items: flex-start; gap: 8px; margin-bottom: 8px; }
.form-check-input { width: 16px; height: 16px; flex-shrink: 0; margin-top: 1px; accent-color: #FF6B00; }
.form-check-label { font-size: 0.75rem; color: rgba(255,255,255,0.8); line-height: 1.3; }
.form-feedback { min-height: 20px; font-size: 0.8rem; margin-bottom: 8px; }
.file-name-display { font-size: 0.7rem; color: rgba(255,255,255,0.6); display: block; margin-top: 4px; }

.btn { display: inline-flex; align-items: center; justify-content: center; gap: 6px; padding: 10px 18px; font-size: 0.85rem; font-weight: 700; border: 2px solid transparent; border-radius: 3px; transition: all 0.15s; cursor: pointer; text-align: center; line-height: 1.2; }
.btn--orange { background-color: #FF6B00; color: #fff; border-color: #FF6B00; }
.btn--orange:hover { background-color: #e85d00; border-color: #e85d00; }
.btn--green { background-color: #004D34; color: #fff; border-color: #004D34; }
.btn--green:hover { background-color: #005f41; }
.btn--outline { background: transparent; color: #fff; border-color: rgba(255,255,255,0.4); }
.btn--outline:hover { background: rgba(255,255,255,0.1); }
.btn--whatsapp { background-color: #25D366; color: #fff; border-color: #25D366; }
.btn--whatsapp:hover { background-color: #1ebe59; }
.btn--social { background: rgba(255,255,255,0.15); color: #fff; padding: 7px 12px; font-size: 0.78rem; margin-bottom: 6px; }
.btn--block { width: 100%; }
.btn--small { padding: 6px 12px; font-size: 0.78rem; }

/* ---- CLASSIFICADOS ---- */
.classificados-grid { display: grid; grid-template-columns: repeat(3, 1fr); gap: 14px; }
.classificado-card { background: #fff; border: 1px solid #e0e0e0; border-radius: 3px; overflow: hidden; transition: box-shadow 0.2s; }
.classificado-card:hover { box-shadow: 0 2px 12px rgba(0,0,0,0.1); }
.classificado-card__thumb { height: 130px; overflow: hidden; background: linear-gradient(135deg, #1c3a1c 0%, #2a5a2a 100%); }
.classificado-card__thumb img { width: 100%; height: 100%; object-fit: cover; }
.classificado-card__content { padding: 12px; }
.classificado-card__title { font-size: 0.88rem; font-weight: 700; margin: 5px 0 5px; color: #1a1a1a; display: -webkit-box; -webkit-line-clamp: 2; -webkit-box-orient: vertical; overflow: hidden; }
.classificado-card__desc { font-size: 0.75rem; color: #777; margin-bottom: 8px; display: -webkit-box; -webkit-line-clamp: 2; -webkit-box-orient: vertical; overflow: hidden; }
.classificado-card__price { font-size: 1rem; font-weight: 900; color: #004D34; margin-bottom: 8px; }
.classificado-card__footer { display: flex; align-items: center; justify-content: space-between; gap: 6px; }
.classificado-card__city { font-size: 0.7rem; color: #aaa; }

/* ---- OBITUÁRIO ---- */
.obituario-grid { display: grid; grid-template-columns: repeat(2, 1fr); gap: 14px; }
.obituario-card { background: #f9f9f9; border: 1px solid #ddd; border-left: 4px solid #556070; border-radius: 3px; padding: 14px; }
.obituario-card__header { display: flex; justify-content: space-between; align-items: flex-start; margin-bottom: 8px; }
.obituario-card__name { font-size: 0.95rem; font-weight: 800; color: #1e293b; line-height: 1.3; }
.obituario-card__age { font-size: 0.75rem; color: #777; white-space: nowrap; }
.obituario-card__body { font-size: 0.78rem; color: #444; }
.obituario-card__body p { margin-bottom: 4px; }
.obituario-card__note { font-style: italic; color: #666; border-top: 1px solid #e0e0e0; padding-top: 6px; margin-top: 6px; font-size: 0.75rem; }

/* ---- FOOTER ---- */
.main-footer { background-color: #004D34; color: #c8ddd6; padding-top: 40px; margin-top: 30px; }

/* Grid: 3 colunas — brand | nav | social */
.main-footer__container {
    display: grid;
    grid-template-columns: 1fr 1.8fr 1fr;
    gap: 32px;
    padding-bottom: 36px;
    align-items: start;
}

/* Coluna 1: Brand */
.main-footer__brand { margin-bottom: 16px; }
.main-footer__logo-img { height: 44px; width: auto; max-width: 180px; object-fit: contain; display: block; }
.main-footer__desc { font-size: 0.88rem; line-height: 1.6; color: #b0cec5; margin-bottom: 14px; }
.main-footer__whatsapp { font-size: 0.88rem; color: #b0cec5; line-height: 1.6; }
.main-footer__whatsapp strong { color: #e0eeea; margin-right: 2px; }
.main-footer__whatsapp-link { color: #e0eeea; font-weight: 700; font-size: 1rem; text-decoration: none; }
.main-footer__whatsapp-link:hover { text-decoration: underline; }

/* Coluna 2: Navegação */
.main-footer__nav-title {
    font-size: 1rem;
    font-weight: 700;
    color: #fff;
    margin-bottom: 16px;
}
/* 2 sub-colunas + linha separadora */
.main-footer__nav-grid {
    display: grid;
    grid-template-columns: 1fr 1px 1fr;
    gap: 0 20px;
    align-items: start;
}
.main-footer__nav-divider {
    width: 1px;
    background-color: rgba(255,255,255,0.2);
    align-self: stretch;
    min-height: 100px;
}
.main-footer__list { margin: 0; padding: 0; list-style: none; }
.main-footer__list li { margin-bottom: 10px; }
.main-footer__list a { font-size: 0.88rem; color: #b0cec5; text-decoration: none; transition: color 0.15s; }
.main-footer__list a:hover { color: #fff; }

/* Coluna 3: Redes Sociais */
.main-footer__social-icons { display: flex; gap: 12px; margin-top: 4px; }
.main-footer__social-icon {
    display: flex;
    align-items: center;
    justify-content: center;
    width: 46px;
    height: 46px;
    border: 2px solid rgba(255,255,255,0.5);
    border-radius: 50%;
    color: #fff;
    transition: border-color 0.15s, background 0.15s;
    flex-shrink: 0;
}
.main-footer__social-icon:hover { border-color: #fff; background: rgba(255,255,255,0.12); }

/* Barra Inferior — fundo claro/branco com texto escuro, igual à referência */
.main-footer__bottom {
    background-color: #f0f0f0;
    border-top: none;
    padding: 16px 0;
    font-size: 0.82rem;
    color: #333;
    text-align: center;
}
.main-footer__bottom-container { display: flex; justify-content: center; align-items: center; }
.main-footer__bottom p { margin: 0; color: #444; }
.main-footer__dev-link { color: #FF6B00; font-weight: 700; text-decoration: none; }
.main-footer__dev-link:hover { text-decoration: underline; }


/* ---- COOKIE BANNER ---- */
.cookie-banner { position: fixed; bottom: 0; left: 0; right: 0; background: #1e293b; color: #e2e8f0; padding: 14px 0; z-index: 10000; box-shadow: 0 -2px 12px rgba(0,0,0,0.3); }
.cookie-banner__container { display: flex; align-items: center; justify-content: space-between; gap: 16px; flex-wrap: wrap; }
.cookie-banner__text { font-size: 0.82rem; line-height: 1.5; flex: 1; }
.cookie-banner__text a { color: #FF6B00; text-decoration: underline; }
.cookie-banner__actions { display: flex; gap: 10px; flex-shrink: 0; }

/* ---- SINGLE POST ---- */
.single-post { padding: 24px 0; }
.breadcrumb { font-size: 0.78rem; color: #888; margin-bottom: 16px; }
.breadcrumb a { color: #004D34; }
.breadcrumb a:hover { text-decoration: underline; }
.single-post__header { margin-bottom: 20px; }
.single-post__title { font-size: 1.85rem; font-weight: 900; line-height: 1.25; color: #1a1a1a; margin: 10px 0 12px; }
.single-post__subtitle { font-size: 1.05rem; color: #555; font-style: italic; margin-bottom: 14px; line-height: 1.5; }
.single-post__meta { display: flex; justify-content: space-between; align-items: center; border-top: 1px solid #eee; border-bottom: 1px solid #eee; padding: 10px 0; font-size: 0.78rem; color: #888; }
.single-post__featured-image { margin-bottom: 24px; border-radius: 4px; overflow: hidden; }
.single-post__featured-image img { width: 100%; max-height: 460px; object-fit: cover; }
.single-post__caption { font-size: 0.75rem; color: #999; padding: 6px 0; border-top: 1px solid #f0f0f0; }
.entry-content { font-size: 0.97rem; line-height: 1.7; color: #2a2a2a; max-width: 720px; }
.entry-content p { margin-bottom: 1.25rem; }
.entry-content h2 { font-size: 1.35rem; margin: 24px 0 12px; }
.entry-content blockquote { border-left: 4px solid #004D34; padding: 12px 18px; background: #f0f7f4; margin: 20px 0; font-style: italic; color: #555; }
.entry-content a { color: #004D34; text-decoration: underline; }

/* ---- STATIC PAGES ---- */
.page-static { padding: 30px 0; max-width: 860px; }
.page-static__title { font-size: 1.6rem; font-weight: 900; margin-bottom: 24px; color: #004D34; }
.page-static__content { font-size: 0.95rem; line-height: 1.75; color: #333; }

/* ---- ERROR PAGES ---- */
.error-page { display: flex; align-items: center; justify-content: center; min-height: 60vh; text-align: center; flex-direction: column; }
.error-page__code { font-size: 6rem; font-weight: 900; color: #004D34; line-height: 1; }
.error-page__title { font-size: 1.5rem; font-weight: 700; margin-bottom: 14px; }
.error-page__text { color: #666; margin-bottom: 24px; }

/* ---- ADMIN ---- */
.admin-body { background: #f1f5f9; }
.admin-login-body { display: flex; align-items: center; justify-content: center; min-height: 100vh; background: linear-gradient(135deg, #004D34 0%, #003025 100%); }
.admin-login-box { background: #fff; padding: 36px 32px; border-radius: 8px; width: 100%; max-width: 400px; box-shadow: 0 12px 40px rgba(0,0,0,0.3); }
.admin-login-header { text-align: center; margin-bottom: 28px; }
.admin-login-title { font-size: 1.7rem; font-weight: 900; color: #004D34; }
.logo-accent { color: #FF6B00; }
.admin-login-subtitle { font-size: 0.82rem; color: #888; margin-top: 4px; }
.admin-login-form .form-group label { font-size: 0.82rem; color: #444; display: block; margin-bottom: 4px; font-weight: 600; }
.admin-login-form .form-control { background: #fff; color: #1a1a1a; border: 1px solid #ddd; }
.admin-login-form .form-control:focus { border-color: #004D34; }
.alert { padding: 12px 14px; border-radius: 4px; font-size: 0.82rem; margin-bottom: 16px; font-weight: 600; }
.alert--danger { background: #fef2f2; color: #991b1b; border: 1px solid #fca5a5; }
.admin-wrapper { display: flex; min-height: 100vh; }
.admin-sidebar {
    width: 260px;
    background: linear-gradient(180deg, #003624 0%, #004D34 100%);
    color: #fff;
    padding: 24px 16px;
    display: flex;
    flex-direction: column;
    justify-content: space-between;
    flex-shrink: 0;
    box-shadow: 3px 0 12px rgba(0,0,0,0.15);
}
.admin-sidebar__brand {
    margin-bottom: 24px;
    padding-bottom: 18px;
    border-bottom: 1px solid rgba(255,255,255,0.12);
    text-align: center;
}
.admin-sidebar__brand-link {
    display: flex;
    flex-direction: column;
    align-items: center;
    text-decoration: none;
    gap: 8px;
}
.admin-sidebar__logo-img {
    height: 44px;
    width: auto;
    max-width: 180px;
    object-fit: contain;
}
.admin-sidebar__badge {
    display: inline-block;
    background: #FF6B00;
    color: #fff;
    font-size: 0.62rem;
    font-weight: 800;
    letter-spacing: 0.6px;
    padding: 2px 8px;
    border-radius: 10px;
    text-transform: uppercase;
}
.admin-sidebar__nav {
    display: flex;
    flex-direction: column;
    gap: 6px;
    flex: 1;
}
.admin-nav-item {
    display: flex;
    align-items: center;
    gap: 12px;
    padding: 11px 14px;
    border-radius: 6px;
    color: rgba(255,255,255,0.8);
    font-weight: 600;
    font-size: 0.88rem;
    text-decoration: none;
    transition: background 0.2s, color 0.2s, border-left 0.2s;
    border-left: 4px solid transparent;
}
.admin-nav-icon {
    flex-shrink: 0;
    width: 20px;
    font-size: 1rem;
    text-align: center;
    opacity: 0.85;
    transition: opacity 0.2s;
}
.admin-nav-item:hover {
    background: rgba(255,255,255,0.08);
    color: #fff;
}
.admin-nav-item:hover .admin-nav-icon { opacity: 1; }
.admin-nav-item.active {
    background: rgba(255,255,255,0.15);
    color: #fff;
    border-left-color: #FF6B00;
    font-weight: 700;
}
.admin-nav-item.active .admin-nav-icon { opacity: 1; color: #FF6B00; }
.admin-nav-item--external {
    margin-top: 6px;
    color: rgba(255,255,255,0.65);
}
.admin-sidebar__divider {
    height: 1px;
    background: rgba(255,255,255,0.12);
    margin: 10px 0;
}

/* User Card Bottom Sidebar */
.admin-sidebar__user {
    border-top: 1px solid rgba(255,255,255,0.12);
    padding-top: 16px;
    display: flex;
    align-items: center;
    justify-content: space-between;
    background: rgba(0,0,0,0.18);
    margin: 16px -16px -24px;
    padding: 14px 16px;
}
.admin-user-info {
    display: flex;
    align-items: center;
    gap: 10px;
    min-width: 0;
}
.admin-user-avatar {
    width: 36px;
    height: 36px;
    border-radius: 50%;
    background: #FF6B00;
    color: #fff;
    font-weight: 800;
    font-size: 0.95rem;
    display: flex;
    align-items: center;
    justify-content: center;
    flex-shrink: 0;
}
.admin-user-details {
    display: flex;
    flex-direction: column;
    min-width: 0;
}
.admin-user-name {
    font-size: 0.85rem;
    font-weight: 700;
    color: #fff;
    white-space: nowrap;
    overflow: hidden;
    text-overflow: ellipsis;
}
.admin-user-email {
    font-size: 0.72rem;
    color: rgba(255,255,255,0.6);
    white-space: nowrap;
    overflow: hidden;
    text-overflow: ellipsis;
}
.btn-logout {
    display: flex;
    align-items: center;
    gap: 4px;
    color: #ff8a65;
    font-size: 0.78rem;
    font-weight: 700;
    text-decoration: none;
    padding: 6px;
    border-radius: 4px;
    transition: background 0.15s, color 0.15s;
}
.btn-logout:hover {
    background: rgba(255,255,255,0.1);
    color: #ffab91;
}

.admin-main { flex: 1; padding: 28px; min-width: 0; }
.admin-title { font-size: 1.6rem; font-weight: 900; color: #1a1a1a; margin-bottom: 22px; }
.admin-stats-grid { display: grid; grid-template-columns: repeat(3, 1fr); gap: 18px; margin-bottom: 28px; }
.stat-card { background: #fff; padding: 20px; border-radius: 6px; border: 1px solid #e2e8f0; border-left: 4px solid #004D34; }
.stat-card__number { font-size: 2.2rem; font-weight: 900; color: #FF6B00; display: block; }
.stat-card__label { font-size: 0.82rem; color: #64748b; font-weight: 600; margin-top: 4px; }
.admin-table-card { background: #fff; padding: 20px; border-radius: 6px; border: 1px solid #e2e8f0; }
.admin-table-card h2 { font-size: 1.1rem; font-weight: 700; color: #1a1a1a; margin-bottom: 14px; }
.admin-table { width: 100%; border-collapse: collapse; font-size: 0.85rem; }
.admin-table th, .admin-table td { padding: 10px 12px; text-align: left; border-bottom: 1px solid #f0f0f0; vertical-align: middle; }
.admin-table th { background: #f8fafc; font-weight: 700; color: #475569; font-size: 0.78rem; text-transform: uppercase; }
.admin-table tr:hover td { background: #fafafa; }

/* Admin Content Management UI */
.admin-page-header { display: flex; justify-content: space-between; align-items: center; margin-bottom: 24px; }
.admin-page-title { font-size: 1.6rem; font-weight: 800; color: #004D34; margin: 0; }

.admin-card { background: #fff; padding: 24px; border-radius: 6px; border: 1px solid #e2e8f0; margin-bottom: 24px; box-shadow: 0 1px 3px rgba(0,0,0,0.05); }

.btn { display: inline-block; padding: 8px 16px; border-radius: 4px; font-weight: 700; font-size: 0.85rem; border: none; cursor: pointer; text-decoration: none; text-align: center; transition: background 0.15s; }
.btn--green { background-color: #004D34; color: #fff; }
.btn--green:hover { background-color: #003624; }
.btn--outline { background-color: transparent; border: 1px solid #ccc; color: #333; }
.btn--outline:hover { background-color: #f5f5f5; }
.btn--block { display: block; width: 100%; }

.btn-action { display: inline-block; padding: 4px 8px; border-radius: 3px; font-size: 0.75rem; font-weight: 700; text-decoration: none; margin-right: 4px; }
.btn-action--edit { background: #e0f2fe; color: #0369a1; }
.btn-action--delete { background: #fee2e2; color: #b91c1c; }

.status-tag { display: inline-block; padding: 3px 8px; border-radius: 3px; font-size: 0.72rem; font-weight: 700; text-transform: uppercase; }
.status-published, .status-approved { background: #dcfce7; color: #15803d; }
.status-draft, .status-pending { background: #fef9c3; color: #a16207; }
.status-rejected { background: #fee2e2; color: #b91c1c; }

.alert--success { background: #dcfce7; color: #15803d; border: 1px solid #bbf7d0; }
.alert--warning { background: #fef9c3; color: #a16207; border: 1px solid #fef08a; }

.admin-form .form-group { margin-bottom: 18px; }
.admin-form .form-label { display: block; font-size: 0.85rem; font-weight: 700; color: #333; margin-bottom: 6px; }
.admin-form .form-control { width: 100%; padding: 10px 12px; font-size: 0.9rem; border: 1px solid #cbd5e1; border-radius: 4px; font-family: inherit; }
.admin-form .form-control:focus { outline: none; border-color: #004D34; box-shadow: 0 0 0 2px rgba(0,77,52,0.15); }


/* ---- RESPONSIVE ---- */
@media (max-width: 1100px) {
  .main-header__search { display: none; }
  .main-header__link { font-size: 0.75rem; padding: 7px 7px; }
}

@media (max-width: 900px) {
  .content-sidebar-grid { grid-template-columns: 1fr; }
  .sidebar-column { display: grid; grid-template-columns: repeat(2, 1fr); gap: 16px; }
  .hero-mosaic__grid { grid-template-columns: 1fr; height: auto; }
  .hero-card--main { height: 280px; }
  .hero-card--secondary { height: 180px; }
  .hero-mosaic__secondary-stack { flex-direction: row; }
  .classificados-grid { grid-template-columns: repeat(2, 1fr); }
  .main-footer__container { grid-template-columns: repeat(2, 1fr); }
  .fala-cidadao__grid { grid-template-columns: 1fr; }
}

@media (max-width: 680px) {
  .main-header__menu { display: none; }
  .main-header__nav.active .main-header__menu { display: flex; }
  .main-header__toggle { display: flex; }
  .main-header__social { display: none; }
  .hero-card--main { height: 220px; }
  .hero-mosaic__secondary-stack { flex-direction: column; }
  .hero-card--secondary { height: 160px; }
  .classificados-grid { grid-template-columns: 1fr; }
  .obituario-grid { grid-template-columns: 1fr; }
  .sidebar-column { display: flex; flex-direction: column; }
  .main-footer__container { grid-template-columns: 1fr; gap: 20px; }
  .main-footer__bottom-container { flex-direction: column; gap: 6px; text-align: center; }
  .registro-card { flex: 0 0 calc(80% - 8px); }
  .admin-stats-grid { grid-template-columns: 1fr 1fr; }
  .hero-card--main .hero-card__title { font-size: 1.1rem; }
}

/* ---- STATIC PAGES (Sobre-nós, Anuncie com a gente, Política de Privacidade) ---- */
.page-static {
    background: #fff;
    padding: 32px 36px;
    margin: 24px auto;
    border: 1px solid #e0e0e0;
    border-radius: 4px;
}
.page-static__title {
    font-size: 1.8rem;
    font-weight: 800;
    color: #004D34;
    margin-bottom: 20px;
    padding-bottom: 12px;
    border-bottom: 2px solid #004D34;
}
.entry-content {
    font-size: 0.98rem;
    line-height: 1.7;
    color: #222;
}
.entry-content h2 {
    font-size: 1.4rem;
    font-weight: 700;
    color: #111;
    margin: 24px 0 12px;
}
.entry-content h3 {
    font-size: 1.15rem;
    font-weight: 700;
    color: #004D34;
    margin: 18px 0 10px;
}
.entry-content p {
    margin-bottom: 14px;
}
.entry-content ul, .entry-content ol {
    margin: 12px 0 18px 24px;
    list-style: disc;
}
.entry-content li {
    margin-bottom: 6px;
}

/* ---- DARK MODE TEMA ESCURO ---- */
body.dark-mode {
    background-color: #0f172a !important;
    color: #e2e8f0 !important;
}
body.dark-mode .main-header {
    background-color: #1e293b !important;
    border-bottom: 1px solid #334155 !important;
}
body.dark-mode .main-header__link {
    color: #cbd5e1 !important;
}
body.dark-mode .main-header__link:hover, body.dark-mode .main-header__link.active {
    color: #4ade80 !important;
}

/* ---- HOME 2026: fidelidade ao layout editorial de referência ---- */
body { background: #fff; }
.container { max-width: 840px; padding-left: 10px; padding-right: 10px; }
.main-body { background: #fff; }

.main-header { position: relative; box-shadow: none; }
.main-header__container { min-height: 50px; height: 50px; padding: 0 10px; gap: 12px; }
.main-header__logo-img { width: 148px; height: auto; max-height: 34px; }
.main-header__nav { display: flex; justify-content: center; }
.main-header__menu { align-items: center; gap: 2px; }
.main-header__link {
  font-size: 0.63rem;
  padding: 6px 7px;
  text-transform: none;
  letter-spacing: 0;
  border-radius: 0;
  color: #fff;
}
.main-header__link:hover, .main-header__link.active { background: transparent; color: #fff; }
.main-header__actions { gap: 6px; }
.main-header__social { gap: 2px; }
.main-header__social-icon { width: 25px; height: 25px; }
.main-header__social-icon svg { width: 14px; height: 14px; }

.top-banner-wrapper { margin: 28px 0 30px; padding: 0; border: 0; }
.top-banner__img { width: 100%; height: 135px; max-height: none; object-fit: cover; }
.hero-mosaic { margin-bottom: 0; }
.hero-mosaic__grid { grid-template-columns: 1.42fr 1fr; height: 395px; gap: 2px; }
.hero-card__content { padding: 10px 12px; }
.hero-card__badge { font-size: 0.58rem; padding: 2px 7px; margin-bottom: 4px; }
.hero-card--main .hero-card__title { font-size: 1.02rem; line-height: 1.22; }
.hero-card__title { font-size: 0.76rem; line-height: 1.23; }

.content-sidebar-grid {
  grid-template-columns: minmax(0, 500px) 275px;
  gap: 45px;
  padding: 48px 0 0;
}
.content-sidebar-grid--middle { padding-top: 16px; }
.section-box { margin-bottom: 32px; }
.section-header { margin-bottom: 12px; }
.section-title {
  font-size: 0.68rem;
  line-height: 1.2;
  padding: 5px 11px;
  text-transform: none;
  letter-spacing: 0;
}
.section-header__line { background: #cfcfcf; }
.news-item { gap: 12px; padding: 9px 0; border-bottom: 0; min-height: 139px; }
.news-item__thumb { width: 140px; height: 132px; }
.news-item__title { font-size: 0.9rem; line-height: 1.28; margin: 6px 0; }
.news-item__meta { font-size: 0.63rem; line-height: 1.45; }
.badge { font-size: 0.58rem; line-height: 1.2; padding: 3px 7px; text-transform: none; letter-spacing: 0; }
.pagination-dots { margin-top: 8px; padding-top: 0; }
.pagination-dot { width: 6px; height: 6px; }

.sidebar { gap: 22px; }
.sidebar .section-header { margin-bottom: 9px; }
.weather-box { padding: 10px 12px; gap: 10px; }
.weather-box__icon svg { width: 54px; height: 54px; }
.weather-box__city { font-size: 0.78rem; }
.weather-box__datetime, .weather-box__stats { font-size: 0.56rem; }
.weather-box__temp { font-size: 0.78rem; }
.weather-box__unit { font-size: 0.65rem; }
.weather-box__divider { height: 38px; }
.most-read__list { gap: 12px; margin-top: 4px; }
.most-read__title { font-size: 0.78rem; line-height: 1.28; }
.ad-block { border: 0; background: transparent; }
.ad-block__content { margin-top: 0; }
.ad-placeholder-black { height: 210px; }

.registros-semana { margin-top: 14px; }
.registros-semana .section-header { max-width: 500px; }
.carousel-track { gap: 34px; padding: 8px 15px; }
.registro-card { flex: 0 0 calc(33.333% - 23px); }
.registro-card__thumb { height: 210px; background: #000; border-radius: 0; }
.registro-card__title { font-size: 0.66rem; margin-top: 8px; }
.carousel-btn { width: 26px; height: 26px; background: #fff; color: #555; border: 2px solid #777; }
.carousel-btn--prev { left: -8px; }
.carousel-btn--next { right: -8px; }

.momento-esporte .news-item__thumb { width: 140px; height: 132px; }
.sidebar-visual-placeholder { width: 100%; height: 274px; background: #000; }
.sidebar-visual-placeholder--offer { height: 274px; }
.agenda-list { padding: 0; }

.fala-cidadao { margin-top: 12px; }
.fala-cidadao__grid { grid-template-columns: minmax(0, 430px) 355px; gap: 35px; }
.fala-cidadao__left { border: 0; padding: 0; }
.fala-cidadao__subtitle { color: #222; font-size: 0.7rem; font-style: normal; margin-bottom: 28px; }
.fala-cidadao__empty-visual { height: 335px; background: #f2f2f2; }
.fala-cidadao__right { border-radius: 0; padding: 22px; }
.fala-cidadao__form-card { min-height: 516px; }
.fala-cidadao__form-title { font-size: 1rem; text-align: left; }
.fala-cidadao__tab-btn, .form-control, .form-label--file-btn, .form-check-label { font-size: 0.63rem; }
.fala-cidadao__disclaimer { font-size: 0.61rem; text-align: left; color: #fff; }

.classificados-section, .obituario-section { margin-top: 44px; }
.classificados-section .section-header, .obituario-section .section-header { max-width: 500px; }
.classificados-grid, .obituario-grid { grid-template-columns: repeat(3, 1fr); gap: 34px; padding: 12px 15px 0; }
.classified-visual-placeholder, .obituary-visual-placeholder { height: 210px; background: #000; }

.main-footer { margin-top: 58px; padding-top: 32px; }
.main-footer__container { grid-template-columns: 1.05fr 1.8fr 1fr; gap: 28px; padding-bottom: 28px; }
.main-footer__logo-img { height: 32px; }
.main-footer__desc, .main-footer__whatsapp, .main-footer__list a { font-size: 0.68rem; }
.main-footer__nav-title { font-size: 0.74rem; margin-bottom: 10px; }
.main-footer__list li { margin-bottom: 6px; }
.main-footer__social-icon { width: 30px; height: 30px; border-width: 1px; }
.main-footer__social-icon svg { width: 15px; height: 15px; }
.main-footer__bottom { padding: 10px 0; font-size: 0.62rem; }

@media (max-width: 900px) {
  .container { max-width: 100%; padding-left: 16px; padding-right: 16px; }
  .main-header__container { height: 58px; }
  .main-header__logo-img { width: 140px; }
  .content-sidebar-grid { grid-template-columns: 1fr; gap: 24px; padding-top: 30px; }
  .sidebar-column { display: block; }
  .hero-mosaic__grid { height: auto; }
  .hero-card--main { height: 300px; }
  .hero-card--secondary { height: 180px; }
  .registros-semana .section-header, .classificados-section .section-header, .obituario-section .section-header { max-width: none; }
  .fala-cidadao__grid { grid-template-columns: 1fr; }
}

@media (max-width: 680px) {
  .top-banner-wrapper { margin: 16px 0; }
  .top-banner__img { height: auto; aspect-ratio: 6 / 1; }
  .hero-card--main { height: 240px; }
  .carousel-track { gap: 12px; padding-left: 8px; padding-right: 8px; }
  .registro-card { flex-basis: 78%; }
  .classificados-grid, .obituario-grid { grid-template-columns: 1fr; gap: 16px; padding: 6px 0 0; }
  .main-footer__container { grid-template-columns: 1fr; }
}
body.dark-mode .single-post,
body.dark-mode .page-static,
body.dark-mode .hero-card,
body.dark-mode .post-card,
body.dark-mode .sidebar-card,
body.dark-mode .admin-card,
body.dark-mode .stat-card,
body.dark-mode .post-reactions {
    background-color: #1e293b !important;
    color: #f1f5f9 !important;
    border-color: #334155 !important;
}
body.dark-mode .single-post__title,
body.dark-mode .page-static__title,
body.dark-mode h1, body.dark-mode h2, body.dark-mode h3,
body.dark-mode .entry-content {
    color: #f8fafc !important;
}
body.dark-mode .entry-content h2, body.dark-mode .entry-content h3 {
    color: #4ade80 !important;
}
body.dark-mode .main-footer {
    background-color: #020617 !important;
}

/* ---- ADMIN: responsive desktop, notebook and compact navigation ---- */
.admin-sidebar {
    position: sticky;
    top: 0;
    height: 100vh;
    overflow-y: auto;
    z-index: 40;
}
.admin-topbar {
    background: #fff;
    border: 1px solid #e2e8f0;
    padding: 12px 20px;
    display: flex;
    justify-content: space-between;
    align-items: center;
    gap: 16px;
    margin-bottom: 24px;
    border-radius: 6px;
}
.admin-topbar__title { font-size: 0.88rem; font-weight: 700; color: #004D34; }
.admin-topbar__notifications {
    position: relative;
    text-decoration: none;
    color: #475569;
    display: flex;
    align-items: center;
    gap: 6px;
    font-size: 0.82rem;
    font-weight: 700;
}
.admin-notification-count {
    background: #dc2626;
    color: #fff;
    min-width: 20px;
    height: 20px;
    padding: 0 6px;
    border-radius: 999px;
    display: inline-flex;
    align-items: center;
    justify-content: center;
    font-size: 0.68rem;
    font-weight: 900;
}
.admin-menu-toggle, .admin-sidebar-overlay { display: none; }
.admin-inline-form { display: inline-flex; margin: 0; vertical-align: middle; }
.admin-inline-form--block { display: block; width: 100%; }
.btn-action, .btn-logout {
    border: 0;
    cursor: pointer;
    font-family: inherit;
}
.admin-split-grid {
    display: grid;
    grid-template-columns: minmax(0, 1fr) minmax(300px, 340px);
    gap: 20px;
    align-items: start;
}
.admin-split-grid--wide-form { grid-template-columns: minmax(0, 1fr) minmax(320px, 360px); }
.admin-card { min-width: 0; overflow-x: auto; }
.admin-table { min-width: 680px; }

@media (max-width: 1280px) and (min-width: 1025px) {
    .admin-sidebar { width: 224px; padding-left: 12px; padding-right: 12px; }
    .admin-main { padding: 22px; }
    .admin-nav-item { gap: 9px; padding: 10px; font-size: 0.8rem; }
    .admin-user-email, .btn-logout span { display: none; }
    .admin-split-grid, .admin-split-grid--wide-form { grid-template-columns: minmax(0, 1fr) 300px; }
}

@media (max-width: 1024px) {
    .admin-sidebar {
        position: fixed;
        left: 0;
        top: 0;
        width: min(300px, 86vw);
        transform: translateX(-105%);
        transition: transform .22s ease;
    }
    .admin-menu-open { overflow: hidden; }
    .admin-menu-open .admin-sidebar { transform: translateX(0); }
    .admin-sidebar-overlay {
        position: fixed;
        inset: 0;
        border: 0;
        background: rgba(15, 23, 42, .48);
        z-index: 35;
        cursor: pointer;
    }
    .admin-menu-open .admin-sidebar-overlay { display: block; }
    .admin-menu-toggle {
        width: 40px;
        height: 40px;
        border: 1px solid #cbd5e1;
        border-radius: 6px;
        background: #fff;
        padding: 9px;
        cursor: pointer;
        flex: 0 0 auto;
    }
    .admin-menu-toggle span { display: block; height: 2px; margin: 4px 0; background: #004D34; border-radius: 2px; }
    .admin-main { width: 100%; padding: 20px; }
    .admin-split-grid, .admin-split-grid--wide-form { grid-template-columns: 1fr; }
    .admin-stats-grid { grid-template-columns: repeat(2, minmax(0, 1fr)); }
}

@media (max-width: 640px) {
    .admin-main { padding: 12px; }
    .admin-topbar { padding: 9px 10px; margin-bottom: 16px; }
    .admin-topbar__title { display: none; }
    .admin-topbar__notifications { margin-left: auto; font-size: 0.72rem; }
    .admin-page-header { align-items: flex-start; gap: 12px; flex-direction: column; }
    .admin-page-title, .admin-title { font-size: 1.3rem; }
    .admin-page-header .btn { width: 100%; }
    .admin-card { padding: 16px; }
    .admin-stats-grid { grid-template-columns: 1fr; gap: 12px; }
    .form-group-grid { grid-template-columns: 1fr !important; }
    .admin-form-actions { align-items: stretch !important; flex-direction: column; gap: 14px; }
    .admin-form-actions .btn { width: 100%; }
}

/* ---- HOME: fluid scale for larger desktop monitors ---- */
@media (min-width: 1200px) {
    .container { max-width: 1160px; padding-left: 18px; padding-right: 18px; }
    .main-header__container { min-height: 58px; height: 58px; }
    .main-header__logo-img { width: 172px; }
    .main-header__link { font-size: 0.72rem; padding-left: 9px; padding-right: 9px; }
    .top-banner__img { height: 170px; }
    .hero-mosaic__grid { height: 475px; }
    .hero-card--main .hero-card__title { font-size: 1.28rem; }
    .hero-card__title { font-size: 0.92rem; }
    .content-sidebar-grid { grid-template-columns: minmax(0, 1fr) 320px; gap: 40px; }
    .news-item__thumb, .momento-esporte .news-item__thumb { width: 180px; height: 150px; }
    .news-item { min-height: 158px; }
    .news-item__title { font-size: 1rem; }
    .registros-semana .section-header,
    .classificados-section .section-header,
    .obituario-section .section-header { max-width: calc(100% - 360px); }
    .registro-card__thumb, .classified-visual-placeholder, .obituary-visual-placeholder { height: 260px; }
    .fala-cidadao__grid { grid-template-columns: minmax(0, 1fr) 380px; gap: 40px; }
    .fala-cidadao__empty-visual { height: 390px; }
    .sidebar-visual-placeholder, .sidebar-visual-placeholder--offer { height: 320px; }
}

@media (min-width: 1440px) {
    .container { max-width: 1260px; }
    .hero-mosaic__grid { height: 520px; }
    .content-sidebar-grid { grid-template-columns: minmax(0, 1fr) 340px; gap: 48px; }
    .registros-semana .section-header,
    .classificados-section .section-header,
    .obituario-section .section-header { max-width: calc(100% - 388px); }
}

/* ---- AD BANNER ROTATOR TRANSITIONS ---- */
.ad-rotator {
    position: relative;
    width: 100%;
    overflow: hidden;
    min-height: 80px;
    display: flex;
    align-items: center;
    justify-content: center;
    border-radius: 4px;
}

.ad-rotator__item {
    position: absolute;
    top: 0;
    left: 0;
    width: 100%;
    height: 100%;
    opacity: 0;
    visibility: hidden;
    transition: opacity 0.8s ease-in-out, transform 0.8s ease-in-out;
    transform: scale(0.97);
    display: flex;
    align-items: center;
    justify-content: center;
    pointer-events: none;
    z-index: 1;
}

.ad-rotator__item.active {
    position: relative;
    opacity: 1;
    visibility: visible;
    transform: scale(1);
    pointer-events: auto;
    z-index: 2;
}

.ad-rotator__item img {
    width: 100%;
    height: auto;
    max-height: 320px;
    object-fit: contain;
    display: block;
    border-radius: 4px;
}

/* ---- ARTICLE DETAIL 2026: editorial reading experience ---- */
.reading-progress {
    width: min(1180px, calc(100% - 32px));
    margin: 22px auto 0;
    display: grid;
    grid-template-columns: minmax(0, 1fr) auto;
    align-items: center;
    gap: 16px;
}
.reading-progress__track { height: 6px; overflow: hidden; border-radius: 999px; background: #e5e7eb; }
.reading-progress__track span { display: block; width: 0; height: 100%; border-radius: inherit; background: #004D34; transition: width .12s linear; }
.reading-progress__label { min-width: 82px; color: #64748b; font-size: .72rem; font-weight: 600; }

.single-post.container { max-width: 1180px; padding: 24px 16px 64px; }
.single-post__breadcrumb {
    display: flex;
    align-items: center;
    gap: 8px;
    margin-bottom: 24px;
    color: #64748b;
    font-size: .78rem;
    white-space: nowrap;
    overflow: hidden;
}
.single-post__breadcrumb a { color: #334155; text-decoration: none; font-weight: 600; }
.single-post__breadcrumb a:hover { color: #004D34; }
.single-post__breadcrumb i { color: #94a3b8; font-size: .65rem; }
.single-post__breadcrumb span { overflow: hidden; text-overflow: ellipsis; }
.single-post__layout { display: grid; grid-template-columns: minmax(0, 1fr) 300px; gap: 72px; align-items: start; }
.single-post__main { min-width: 0; }
.single-post__header { margin-bottom: 18px; }
.single-post__category {
    display: inline-flex;
    align-items: center;
    min-height: 29px;
    padding: 5px 13px;
    background: #004D34;
    color: #fff;
    font-size: .72rem;
    line-height: 1;
    font-weight: 800;
    text-decoration: none;
}
.single-post__title {
    max-width: 820px;
    margin: 18px 0 12px;
    color: #0f172a;
    font-size: clamp(2.2rem, 3vw, 2.65rem);
    line-height: 1.16;
    letter-spacing: -.035em;
    font-weight: 850;
}
.single-post__subtitle {
    max-width: 780px;
    margin: 0 0 18px;
    color: #64748b;
    font-size: 1.08rem;
    font-style: normal;
    line-height: 1.55;
    font-weight: 500;
}
.single-post__meta {
    display: flex;
    align-items: center;
    justify-content: space-between;
    gap: 24px;
    padding: 16px 0 15px;
    border-top: 1px solid #dbe1e7;
    border-bottom: 1px solid #dbe1e7;
}
.single-post__author { display: flex; align-items: center; gap: 12px; min-width: 0; }
.single-post__author-avatar {
    width: 50px;
    height: 50px;
    flex: 0 0 auto;
    display: grid;
    place-items: center;
    overflow: hidden;
    border-radius: 50%;
    background: #004D34;
    border: 2px solid #e2e8f0;
}
.single-post__author-avatar img { width: 43px; height: 32px; object-fit: contain; }
.single-post__author p { margin: 0; color: #334155; font-size: .78rem; line-height: 1.5; }
.single-post__author strong { color: #0f172a; font-size: .88rem; }
.single-post__date { color: #64748b !important; }
.single-post__date span { white-space: nowrap; }
.single-post__stats { display: flex; align-items: center; gap: 18px; margin-top: 2px !important; color: #475569 !important; }
.single-post__stats span { display: inline-flex; align-items: center; gap: 5px; }
.single-post__share { display: flex; align-items: center; gap: 9px; flex: 0 0 auto; }
.single-post__share > span { margin-right: 3px; color: #334155; font-size: .72rem; font-weight: 800; }
.share-button {
    width: 42px;
    height: 42px;
    display: inline-grid;
    place-items: center;
    border: 0;
    border-radius: 50%;
    color: #fff;
    font-size: 1.25rem;
    text-decoration: none;
    cursor: pointer;
    transition: transform .18s ease, box-shadow .18s ease;
}
.share-button:hover, .share-button:focus-visible { color: #fff; transform: translateY(-2px); box-shadow: 0 6px 18px rgba(15, 23, 42, .18); }
.share-button--whatsapp { background: #25D366; }
.share-button--facebook { background: #1877F2; }
.share-button--copy { background: #475569; }

.single-post__featured-image { margin: 0 0 24px; overflow: visible; border-radius: 0; background: transparent; }
.single-post__image-button { display: block; width: 100%; padding: 0; overflow: hidden; border: 0; background: #e2e8f0; cursor: zoom-in; }
.single-post__image-button img { display: block; width: 100%; aspect-ratio: 2.05 / 1; max-height: none; object-fit: cover; transition: transform .35s ease; }
.single-post__image-button:hover img { transform: scale(1.012); }
.single-post__caption { padding: 8px 0 0; border: 0; background: transparent; color: #64748b; font-size: .72rem; line-height: 1.45; }
.single-post__caption span { color: #475569; }
.single-post__reading-column { max-width: 760px; }
.audio-player-widget {
    display: flex;
    align-items: center;
    justify-content: space-between;
    gap: 16px;
    margin: 30px 0;
    padding: 13px 16px;
    border: 1px solid #cbd5e1;
    border-left: 4px solid #004D34;
    background: #f8fafc;
}
.audio-player-widget__copy { display: flex; align-items: center; gap: 11px; }
.audio-player-widget__copy > i { color: #004D34; font-size: 1.4rem; }
.audio-player-widget__copy strong, .audio-player-widget__copy span { display: block; }
.audio-player-widget__copy strong { color: #0f172a; font-size: .83rem; }
.audio-player-widget__copy span { margin-top: 2px; color: #64748b; font-size: .7rem; }
.audio-player-widget__button {
    display: inline-flex;
    align-items: center;
    justify-content: center;
    gap: 6px;
    min-height: 36px;
    padding: 7px 13px;
    border: 0;
    border-radius: 3px;
    background: #004D34;
    color: #fff;
    font-family: inherit;
    font-size: .75rem;
    font-weight: 800;
    cursor: pointer;
}
.audio-player-widget__button:disabled { opacity: .55; cursor: not-allowed; }
.single-post__body { color: #1e293b; font-size: 1.04rem; line-height: 1.88; }
.single-post__body p { margin: 0 0 1.35em; }
.single-post__body > p:first-child::first-letter { float: left; margin: .1em .11em 0 0; color: #004D34; font-size: 3.35rem; line-height: .78; font-weight: 800; }
.single-post__body h2 { margin: 2em 0 .65em; color: #0f172a; font-size: 1.5rem; line-height: 1.3; }
.single-post__body a { color: #004D34; text-decoration-thickness: 1px; text-underline-offset: 3px; }
.single-post__body img { max-width: 100%; height: auto; }

.post-reactions {
    display: flex;
    align-items: center;
    justify-content: space-between;
    gap: 22px;
    margin-top: 40px;
    padding: 20px 0;
    border-top: 1px solid #dbe1e7;
    border-bottom: 1px solid #dbe1e7;
    background: transparent;
    text-align: left;
}
.post-reactions h2 { margin: 0 0 4px; color: #0f172a; font-size: .95rem; }
.post-reactions p { margin: 0; color: #64748b; font-size: .72rem; }
.post-reactions__actions { display: flex; gap: 7px; flex-wrap: wrap; justify-content: flex-end; }
.btn-reaction {
    min-height: 34px;
    padding: 6px 10px;
    border: 1px solid #cbd5e1;
    border-radius: 999px;
    background: #fff;
    color: #334155;
    font-family: inherit;
    font-size: .7rem;
    font-weight: 700;
    cursor: pointer;
}
.btn-reaction:hover, .btn-reaction.is-active { border-color: #004D34; background: #004D34; color: #fff; }
.btn-reaction span { margin-left: 3px; }
.single-post__footer-actions { display: flex; align-items: center; justify-content: space-between; gap: 16px; margin-top: 28px; }
.single-post__back, .single-post__whatsapp-cta { display: inline-flex; align-items: center; gap: 7px; font-size: .76rem; font-weight: 800; text-decoration: none; }
.single-post__back { color: #334155; }
.single-post__whatsapp-cta { padding: 9px 13px; border-radius: 3px; background: #25D366; color: #fff; }

.single-post__sidebar { position: sticky; top: 18px; padding-top: 72px; }
.single-post__sidebar-heading { display: flex; align-items: center; margin-bottom: 10px; }
.single-post__sidebar-heading h2 { flex: 0 0 auto; margin: 0; padding: 5px 12px; background: #004D34; color: #fff; font-size: .74rem; line-height: 1; text-transform: none; }
.single-post__sidebar-heading span { height: 1px; flex: 1; background: #cbd5e1; }
.single-post__most-read ol { margin: 0; padding: 0; list-style: none; counter-reset: most-read; }
.single-post__most-read li { counter-increment: most-read; display: grid; grid-template-columns: 34px 1fr; align-items: start; gap: 10px; padding: 18px 4px; border-bottom: 1px solid #dbe1e7; }
.single-post__most-read li::before { content: counter(most-read); color: #006344; font-size: 1.8rem; line-height: 1; font-weight: 800; }
.single-post__most-read a { color: #172033; font-size: .78rem; line-height: 1.48; font-weight: 600; text-decoration: none; }
.single-post__most-read a:hover { color: #004D34; }
.single-post__advertisement { margin-top: 34px; }
.single-post__advertisement > a { display: block; overflow: hidden; background: #07111d; }
.single-post__advertisement img { display: block; width: 100%; aspect-ratio: 1 / 1; object-fit: contain; background: #05080f; }
.single-post__house-ad img { object-position: center; }

.article-lightbox { width: min(1100px, calc(100% - 32px)); max-width: none; padding: 0; border: 0; background: transparent; overflow: visible; }
.article-lightbox::backdrop { background: rgba(2, 6, 23, .9); }
.article-lightbox img { display: block; width: 100%; max-height: 88vh; object-fit: contain; }
.article-lightbox form { position: absolute; top: 12px; right: 12px; z-index: 2; }
.article-lightbox button { width: 38px; height: 38px; border: 0; border-radius: 50%; background: #fff; color: #0f172a; font-size: 1rem; cursor: pointer; box-shadow: 0 4px 14px rgba(15, 23, 42, .25); }
.copy-toast { position: fixed; right: 24px; bottom: 24px; z-index: 1000; padding: 10px 14px; border-radius: 4px; background: #004D34; color: #fff; font-size: .76rem; font-weight: 700; opacity: 0; transform: translateY(8px); pointer-events: none; transition: .2s ease; }
.copy-toast.is-visible { opacity: 1; transform: translateY(0); }

@media (max-width: 1100px) {
    .single-post__layout { grid-template-columns: minmax(0, 1fr) 270px; gap: 40px; }
    .single-post__title { font-size: clamp(2rem, 4vw, 2.65rem); }
    .single-post__meta { align-items: flex-end; }
    .single-post__share > span { display: none; }
}

@media (max-width: 900px) {
    .reading-progress { margin-top: 16px; }
    .single-post.container { max-width: 760px; padding-top: 20px; }
    .single-post__layout { grid-template-columns: 1fr; gap: 48px; }
    .single-post__sidebar { position: static; display: grid; grid-template-columns: 1fr 280px; gap: 30px; padding-top: 0; }
    .single-post__advertisement { margin-top: 0; }
    .single-post__reading-column { max-width: none; }
}

@media (max-width: 680px) {
    .reading-progress { width: calc(100% - 24px); grid-template-columns: 1fr; gap: 5px; }
    .reading-progress__label { text-align: right; font-size: .64rem; }
    .single-post.container { padding: 18px 16px 48px; }
    .single-post__breadcrumb { margin-bottom: 18px; font-size: .7rem; }
    .single-post__title { margin-top: 14px; font-size: 2rem; line-height: 1.16; }
    .single-post__subtitle { font-size: .96rem; }
    .single-post__meta { align-items: flex-start; flex-direction: column; gap: 16px; }
    .single-post__share > span { display: inline; }
    .single-post__image-button img { aspect-ratio: 4 / 3; }
    .audio-player-widget { align-items: stretch; flex-direction: column; }
    .audio-player-widget__button { width: 100%; }
    .single-post__body { font-size: 1rem; line-height: 1.78; }
    .post-reactions { align-items: flex-start; flex-direction: column; }
    .post-reactions__actions { justify-content: flex-start; }
    .single-post__footer-actions { align-items: stretch; flex-direction: column; }
    .single-post__whatsapp-cta { justify-content: center; }
    .single-post__sidebar { grid-template-columns: 1fr; }
    .single-post__advertisement img { aspect-ratio: 16 / 9; }
}

@media print {
    .reading-progress, .single-post__share, .audio-player-widget, .post-reactions, .single-post__footer-actions, .single-post__sidebar, .main-header, .main-footer, .cookie-banner { display: none !important; }
    .single-post__layout { display: block; }
    .single-post.container { max-width: none; }
}

/* ---- HOME OPTION 1: capa editorial dinâmica ---- */
body.home-page { background: #fff; color: #15181d; }
body.home-page .container { width: 91.5%; max-width: 1404px; padding-left: 0; padding-right: 0; }

body.home-page .main-header { position: relative; min-height: 74px; background: #005039; box-shadow: none; }
body.home-page .main-header__container { width: 91.5%; max-width: 1404px; min-height: 74px; height: 74px; padding: 0; gap: 36px; }
body.home-page .main-header__logo-img { width: 198px; height: auto; max-height: 48px; }
body.home-page .main-header__nav { display: flex; justify-content: center; }
body.home-page .main-header__menu { align-items: center; justify-content: center; gap: 12px; }
body.home-page .main-header__link { padding: 9px 10px; color: #fff; font-size: .83rem; font-weight: 700; text-transform: none; letter-spacing: 0; border-radius: 0; }
body.home-page .main-header__link:hover,
body.home-page .main-header__link.active { background: transparent; color: #fff; }
body.home-page .main-header__link:hover { background: transparent; color: #ff8a1f; }
body.home-page .main-header__social { align-items: center; gap: 5px; }
body.home-page .main-header__social-icon { width: 34px; height: 34px; font-size: 1.15rem; opacity: 1; }
body.home-page .main-header__search-link { margin-left: 7px; font-size: 1.3rem; }
body.home-page .main-header__social-icon:hover { color: #ff8a1f; }

body.home-page .page-home { overflow: hidden; }
body.home-page .top-banner-wrapper { margin: 22px 0 14px; padding: 0; border: 0; background: #fff; }
body.home-page .top-banner__img { width: 100%; height: clamp(128px, 10.2vw, 156px); max-height: 156px; object-fit: cover; object-position: center; }

body.home-page .hero-mosaic__grid { grid-template-columns: minmax(0, 1.34fr) minmax(420px, 1fr); height: clamp(400px, 31.25vw, 480px); gap: 3px; }
body.home-page .hero-mosaic__secondary-stack { gap: 3px; }
body.home-page .hero-card__bg { transition: transform .45s ease, filter .45s ease; }
body.home-page .hero-card:hover .hero-card__bg { transform: scale(1.025); filter: saturate(1.06); }
body.home-page .hero-card__overlay { background: linear-gradient(to top, rgba(5, 15, 25, .94) 0%, rgba(5, 15, 25, .62) 33%, rgba(5, 15, 25, .08) 70%); }
body.home-page .hero-card__content { padding: 20px 24px 18px; }
body.home-page .hero-card__badge { margin-bottom: 10px; padding: 4px 11px; background: #006344; color: #fff; font-size: .68rem; font-weight: 800; text-transform: uppercase; letter-spacing: .15px; }
body.home-page .hero-card--main .hero-card__title { width: 85%; max-width: 760px; font-size: clamp(1.65rem, 2.05vw, 2rem); line-height: 1.16; letter-spacing: -.03em; text-shadow: 0 2px 9px rgba(0,0,0,.5); }
body.home-page .hero-card__summary { max-width: 700px; margin: 8px 0 9px; color: rgba(255,255,255,.93); font-size: .98rem; line-height: 1.42; }
body.home-page .hero-card__meta { display: flex; align-items: center; flex-wrap: wrap; gap: 8px; color: rgba(255,255,255,.88); font-size: .77rem; line-height: 1.3; }
body.home-page .hero-card--secondary .hero-card__content { padding: 18px 22px; }
body.home-page .hero-card--secondary .hero-card__badge { margin-bottom: 8px; }
body.home-page .hero-card--secondary .hero-card__title { max-width: 520px; margin-bottom: 8px; font-size: clamp(1.03rem, 1.42vw, 1.38rem); line-height: 1.2; letter-spacing: -.02em; }

body.home-page .content-sidebar-grid { grid-template-columns: minmax(0, 1.55fr) minmax(390px, 1fr); gap: 48px; padding: 30px 0 0; }
body.home-page .content-sidebar-grid--middle { padding-top: 22px; }
body.home-page .section-box { margin-bottom: 34px; }
body.home-page .section-header { position: relative; align-items: center; margin-bottom: 16px; gap: 14px; }
body.home-page .section-title { position: relative; padding: 0 0 10px; background: transparent; color: #005039; font-size: .86rem; line-height: 1.1; font-weight: 800; text-transform: uppercase; letter-spacing: .02em; }
body.home-page .section-title::after { content: ""; position: absolute; left: 0; bottom: 0; width: 42px; height: 3px; background: #ff7a16; }
body.home-page .section-header__line { margin-bottom: 9px; background: #d3d7d6; }

body.home-page .news-item { min-height: 152px; gap: 24px; padding: 13px 0 16px; border-bottom: 1px solid #e1e4e3; }
body.home-page .news-item:first-child { padding-top: 0; }
body.home-page .news-item__thumb { width: 250px; height: 138px; border-radius: 0; background: #eef1f0; }
body.home-page .news-item__title { margin: 9px 0 12px; color: #12171a; font-size: 1.05rem; line-height: 1.3; letter-spacing: -.015em; }
body.home-page .news-item__meta { color: #47504d; font-size: .71rem; line-height: 1.5; }
body.home-page .badge { padding: 4px 9px; border-radius: 0; font-size: .64rem; text-transform: uppercase; letter-spacing: .02em; }
body.home-page .pagination-dot { width: 6px; height: 6px; }

body.home-page .sidebar { gap: 20px; }
body.home-page .sidebar .section-header { margin-bottom: 10px; }
body.home-page .weather-box { display: grid; grid-template-columns: 70px auto 1px minmax(0,1fr); min-height: 137px; padding: 18px 24px; gap: 18px; border-color: #d5d9d8; }
body.home-page .weather-box__icon { color: #ff8a1f; font-size: 4.5rem; line-height: 1; }
body.home-page .weather-box__content { align-self: center; }
body.home-page .weather-box__city { font-size: .9rem; }
body.home-page .weather-box__datetime { margin-bottom: 7px; font-size: .68rem; }
body.home-page .weather-box__temp { align-self: center; font-size: 1.72rem; line-height: 1; }
body.home-page .weather-box__condition { display: block; margin-top: 7px; color: #4d5653; font-size: .65rem; font-weight: 500; text-align: center; }
body.home-page .weather-box__unit { display: none; }
body.home-page .weather-box__divider { align-self: center; height: 72px; }
body.home-page .weather-box__stats { font-size: .71rem; line-height: 1.5; }

body.home-page .most-read__list { counter-reset: home-most-read; gap: 0; margin-top: 0; }
body.home-page .most-read__item { counter-increment: home-most-read; display: grid; grid-template-columns: 28px minmax(0,1fr); gap: 10px; align-items: start; padding: 11px 4px; border-bottom: 1px solid #e1e4e3; }
body.home-page .most-read__item::before { content: counter(home-most-read); color: #006344; font-size: 1.05rem; font-weight: 800; line-height: 1.3; }
body.home-page .most-read__title { font-size: .88rem; line-height: 1.35; }

@media (max-width: 1180px) {
    body.home-page .main-header__container { gap: 16px; }
    body.home-page .main-header__menu { gap: 2px; }
    body.home-page .main-header__link { padding-left: 7px; padding-right: 7px; font-size: .74rem; }
    body.home-page .hero-mosaic__grid { grid-template-columns: minmax(0, 1.3fr) minmax(360px, 1fr); }
    body.home-page .content-sidebar-grid { grid-template-columns: minmax(0, 1.45fr) minmax(340px, 1fr); gap: 34px; }
    body.home-page .news-item__thumb { width: 210px; }
}

@media (max-width: 900px) {
    body.home-page .container,
    body.home-page .main-header__container { width: calc(100% - 32px); }
    body.home-page .main-header__menu { gap: 0; }
    body.home-page .main-header__link { font-size: .67rem; padding-left: 5px; padding-right: 5px; }
    body.home-page .main-header__social-icon:nth-child(-n+3) { display: none; }
    body.home-page .top-banner__img { height: auto; aspect-ratio: 7.5 / 1; }
    body.home-page .hero-mosaic__grid { display: grid; grid-template-columns: 1fr; height: auto; }
    body.home-page .hero-card--main { height: 390px; }
    body.home-page .hero-mosaic__secondary-stack { flex-direction: row; height: 230px; }
    body.home-page .hero-card--secondary { height: 230px; }
    body.home-page .content-sidebar-grid { grid-template-columns: 1fr; gap: 28px; }
    body.home-page .sidebar-column { display: block; }
}

@media (max-width: 680px) {
    body.home-page .container,
    body.home-page .main-header__container { width: calc(100% - 24px); }
    body.home-page .main-header,
    body.home-page .main-header__container { min-height: 62px; height: 62px; }
    body.home-page .main-header__logo-img { width: 160px; }
    body.home-page .main-header__nav { display: block; }
    body.home-page .main-header__social { display: none; }
    body.home-page .top-banner-wrapper { margin: 14px 0 10px; }
    body.home-page .top-banner__img { aspect-ratio: 6 / 1; }
    body.home-page .hero-card--main { height: 340px; }
    body.home-page .hero-card--main .hero-card__title { font-size: 1.45rem; }
    body.home-page .hero-card__summary { display: none; }
    body.home-page .hero-card__content { padding: 18px; }
    body.home-page .hero-mosaic__secondary-stack { flex-direction: column; height: auto; }
    body.home-page .hero-card--secondary { height: 210px; }
    body.home-page .hero-card--secondary .hero-card__title { font-size: 1rem; }
    body.home-page .content-sidebar-grid { padding-top: 24px; }
    body.home-page .news-item { gap: 14px; min-height: 112px; }
    body.home-page .news-item__thumb { width: 118px; height: 100px; }
    body.home-page .news-item__title { margin: 6px 0; font-size: .85rem; }
    body.home-page .news-item__meta { font-size: .62rem; }
    body.home-page .weather-box { grid-template-columns: 56px auto 1px minmax(0,1fr); padding: 16px; gap: 12px; }
    body.home-page .weather-box__icon { font-size: 3.7rem; }
}
/* Albums and immersive photo gallery */
.albums-page,.album-gallery-page{padding-top:26px;padding-bottom:64px}.albums-breadcrumb{display:flex;align-items:center;gap:8px;margin-bottom:28px;color:#64748b;font-size:.75rem}.albums-breadcrumb a{color:#00563d;font-weight:700;text-decoration:none}.albums-page__header,.album-gallery-page__header{max-width:820px;margin-bottom:30px}.albums-page__eyebrow{margin:0 0 7px;color:#e87924;font-size:.72rem;font-weight:800;letter-spacing:.12em;text-transform:uppercase}.albums-page__header h1,.album-gallery-page__header h1{margin:0;color:#10231d;font-size:clamp(2rem,5vw,3.35rem);line-height:1.08}.albums-page__header>p:last-child,.album-gallery-page__description{margin:12px 0 0;color:#52615c;font-size:.98rem;line-height:1.7}.albums-grid{display:grid;grid-template-columns:repeat(3,minmax(0,1fr));gap:24px}.album-card{overflow:hidden;border:1px solid #dfe7e3;border-radius:8px;background:#fff;box-shadow:0 8px 24px rgba(14,48,37,.06);transition:transform .2s ease,box-shadow .2s ease}.album-card:hover{transform:translateY(-4px);box-shadow:0 14px 34px rgba(14,48,37,.12)}.album-card__link{display:block;height:100%;color:inherit;text-decoration:none}.album-card__media{position:relative;overflow:hidden;aspect-ratio:3/2;background:#e8efec}.album-card__media img{width:100%;height:100%;object-fit:cover;transition:transform .35s ease}.album-card:hover .album-card__media img{transform:scale(1.035)}.album-card__count{position:absolute;right:12px;bottom:12px;padding:6px 9px;border-radius:4px;background:rgba(0,47,33,.88);color:#fff;font-size:.7rem;font-weight:800;backdrop-filter:blur(5px)}.album-card__body{display:flex;min-height:190px;flex-direction:column;padding:18px}.album-card__body time{color:#e87924;font-size:.68rem;font-weight:800}.album-card__body h2{margin:6px 0 8px;color:#17382e;font-size:1.08rem;line-height:1.35}.album-card__body p{display:-webkit-box;overflow:hidden;margin:0 0 14px;color:#64748b;font-size:.78rem;line-height:1.55;-webkit-box-orient:vertical;-webkit-line-clamp:2}.album-card__action{display:inline-flex;align-items:center;gap:7px;margin-top:auto;color:#00563d;font-size:.76rem;font-weight:800}.albums-empty{padding:54px 24px;border:1px dashed #afc4bc;border-radius:8px;background:#f6faf8;text-align:center}.albums-empty strong{color:#174537;font-size:1.15rem}.albums-empty p{margin:7px 0 0;color:#64748b}.album-gallery-page__back{display:inline-flex;align-items:center;gap:7px;margin-bottom:22px;color:#00563d;font-size:.78rem;font-weight:800;text-decoration:none}.album-gallery-page__meta{display:flex;gap:18px;margin-top:14px;color:#64748b;font-size:.76rem}.album-gallery-page__meta>*{display:inline-flex;align-items:center;gap:6px}.album-photo-grid{display:grid;grid-template-columns:repeat(3,minmax(0,1fr));gap:16px}.album-photo-card{min-width:0;margin:0}.album-photo-card__button{position:relative;display:block;width:100%;overflow:hidden;padding:0;border:0;border-radius:6px;aspect-ratio:4/3;background:#dce7e2;cursor:zoom-in}.album-photo-card__button img{display:block;width:100%;height:100%;object-fit:cover;transition:transform .3s ease,filter .3s ease}.album-photo-card__button:hover img,.album-photo-card__button:focus-visible img{transform:scale(1.035);filter:brightness(.8)}.album-photo-card__button:focus-visible{outline:3px solid #f28a3a;outline-offset:3px}.album-photo-card__zoom{position:absolute;top:50%;left:50%;display:grid;width:44px;height:44px;place-items:center;border:1px solid rgba(255,255,255,.7);border-radius:50%;background:rgba(0,45,32,.72);color:#fff;font-size:1.1rem;opacity:0;transform:translate(-50%,-45%);transition:opacity .2s ease,transform .2s ease}.album-photo-card__button:hover .album-photo-card__zoom,.album-photo-card__button:focus-visible .album-photo-card__zoom{opacity:1;transform:translate(-50%,-50%)}.album-photo-card figcaption{padding:8px 2px 3px;color:#52615c;font-size:.74rem;line-height:1.45}.gallery-is-open{overflow:hidden}.gallery-lightbox{width:100vw;max-width:none;height:100vh;max-height:none;margin:0;padding:0;border:0;background:rgba(3,12,9,.96);color:#fff}.gallery-lightbox::backdrop{background:rgba(3,12,9,.96)}.gallery-lightbox__stage{display:grid;height:100%;grid-template:60px minmax(0,1fr) 72px/72px minmax(0,1fr) 72px}.gallery-lightbox__topbar{z-index:2;display:flex;grid-column:1/-1;align-items:center;justify-content:space-between;padding:8px 18px;border-bottom:1px solid rgba(255,255,255,.12)}.gallery-lightbox__counter{font-size:.78rem;font-weight:800}.gallery-lightbox__tools{display:flex;align-items:center;gap:7px}.gallery-lightbox__tools button,.gallery-lightbox__nav{display:grid;min-width:40px;height:40px;place-items:center;border:1px solid rgba(255,255,255,.22);border-radius:50%;background:rgba(255,255,255,.08);color:#fff;cursor:pointer}.gallery-lightbox__tools [data-zoom-reset]{width:auto;padding:0 12px;border-radius:20px;font-size:.7rem;font-weight:800}.gallery-lightbox__tools button:hover,.gallery-lightbox__tools button:focus-visible,.gallery-lightbox__nav:hover,.gallery-lightbox__nav:focus-visible{border-color:#f28a3a;background:#f28a3a;outline:0}.gallery-lightbox__viewport{display:flex;overflow:auto;grid-area:2/2;align-items:center;justify-content:center;overscroll-behavior:contain}.gallery-lightbox__viewport.is-zoomed{align-items:flex-start;justify-content:flex-start}.gallery-lightbox__viewport img{display:block;max-width:100%;max-height:100%;margin:auto;object-fit:contain;transform-origin:center center;transition:transform .18s ease;user-select:none}.gallery-lightbox__nav{align-self:center}.gallery-lightbox__nav--prev{grid-area:2/1;justify-self:center}.gallery-lightbox__nav--next{grid-area:2/3;justify-self:center}.gallery-lightbox__footer{display:flex;grid-column:1/-1;align-items:center;justify-content:space-between;gap:20px;padding:10px 22px;border-top:1px solid rgba(255,255,255,.12)}.gallery-lightbox__footer p{margin:0;font-size:.82rem}.gallery-lightbox__footer span{color:#9fb0aa;font-size:.68rem}.gallery-lightbox[open]{animation:galleryFade .18s ease}@keyframes galleryFade{from{opacity:0}to{opacity:1}}@media(max-width:900px){.albums-grid,.album-photo-grid{grid-template-columns:repeat(2,minmax(0,1fr))}}@media(max-width:620px){.albums-page,.album-gallery-page{padding-top:18px}.albums-grid{grid-template-columns:1fr}.album-photo-grid{grid-template-columns:repeat(2,minmax(0,1fr));gap:8px}.album-gallery-page__meta{flex-wrap:wrap}.gallery-lightbox__stage{grid-template:54px minmax(0,1fr) 84px/48px minmax(0,1fr) 48px}.gallery-lightbox__topbar{padding:7px 9px}.gallery-lightbox__tools{gap:4px}.gallery-lightbox__tools button,.gallery-lightbox__nav{min-width:36px;width:36px;height:36px}.gallery-lightbox__tools [data-zoom-reset]{display:none}.gallery-lightbox__footer{align-items:flex-start;flex-direction:column;justify-content:center;gap:3px;padding:8px 12px}.gallery-lightbox__footer span{display:none}}
.gallery-lightbox__viewport.is-zoomed img{margin:0;transform-origin:top left}